C8H12Cl2N2 — CID 143531721
(3,4-dichlorophenyl)hydrazine;ethane (PubChem CID 143531721) has the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. Its IUPAC name is (3,4-dichlorophenyl)hydrazine;ethane.
| Compound Name | (3,4-dichlorophenyl)hydrazine;ethane |
|---|---|
| PubChem CID | 143531721 |
| Molecular Formula | C8H12Cl2N2 |
| Molecular Weight | 207.10 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | (3,4-dichlorophenyl)hydrazine;ethane |
| SMILES | CC.NNc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H6Cl2N2.C2H6/c7-5-2-1-4(10-9)3-6(5)8;1-2/h1-3,10H,9H2;1-2H3 |
| InChIKey | LWWJXAKZPSTCRA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|