C12H13Cl2N5 — CID 80926306
N-(3,4-dichlorophenyl)-6-hydrazinyl-2,5-dimethylpyrimidin-4-amine (PubChem CID 80926306) has the molecular formula C12H13Cl2N5 and a molecular weight of 298.18 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-6-hydrazinyl-2,5-dimethylpyrimidin-4-amine.
| Compound Name | N-(3,4-dichlorophenyl)-6-hydrazinyl-2,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80926306 |
| Molecular Formula | C12H13Cl2N5 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | N-(3,4-dichlorophenyl)-6-hydrazinyl-2,5-dimethylpyrimidin-4-amine |
| SMILES | Cc1nc(NN)c(C)c(Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C12H13Cl2N5/c1-6-11(16-7(2)17-12(6)19-15)18-8-3-4-9(13)10(14)5-8/h3-5H,15H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | ZKIGBQPUTFNXRO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|