C12H14FN5 — CID 80927488
N-(4-fluorophenyl)-6-hydrazinyl-2,5-dimethylpyrimidin-4-amine (PubChem CID 80927488) has the molecular formula C12H14FN5 and a molecular weight of 247.28 g/mol. Its IUPAC name is N-(4-fluorophenyl)-6-hydrazinyl-2,5-dimethylpyrimidin-4-amine.
| Compound Name | N-(4-fluorophenyl)-6-hydrazinyl-2,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80927488 |
| Molecular Formula | C12H14FN5 |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-(4-fluorophenyl)-6-hydrazinyl-2,5-dimethylpyrimidin-4-amine |
| SMILES | Cc1nc(NN)c(C)c(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C12H14FN5/c1-7-11(15-8(2)16-12(7)18-14)17-10-5-3-9(13)4-6-10/h3-6H,14H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | QLCJTMMMNFIPCT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|