About 4-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]benzene-1,2-dicarbonitrile
4-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]benzene-1,2-dicarbonitrile (PubChem CID 107795475) has the molecular formula C14H13N7
and a molecular weight of 279.31 g/mol. Its IUPAC name is 4-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]benzene-1,2-dicarbonitrile |
| PubChem CID | 107795475 |
| Molecular Formula | C14H13N7 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 4-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]benzene-1,2-dicarbonitrile |
| SMILES | Cc1nc(NN)c(C)c(Nc2ccc(C#N)c(C#N)c2)n1 |
| InChI | InChI=1S/C14H13N7/c1-8-13(18-9(2)19-14(8)21-17)20-12-4-3-10(6-15)11(5-12)7-16/h3-5H,17H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | YFOPDVDMFGFHAV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 123.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]benzene-1,2-dicarbonitrile?
The IUPAC name of 4-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]benzene-1,2-dicarbonitrile (CID 107795475) is 4-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]benzene-1,2-dicarbonitrile?
The canonical SMILES for 4-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]benzene-1,2-dicarbonitrile is Cc1nc(NN)c(C)c(Nc2ccc(C#N)c(C#N)c2)n1.
What is the InChIKey of 4-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]benzene-1,2-dicarbonitrile?
The InChIKey is YFOPDVDMFGFHAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N7/c1-8-13(18-9(2)19-14(8)21-17)20-12-4-3-10(6-15)11(5-12)7-16/h3-5H,17H2,1-2H3,(H2,18,19,20,21).
What are the key properties of 4-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]benzene-1,2-dicarbonitrile?
4-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]benzene-1,2-dicarbonitrile has a molecular weight of 279.31 g/mol, XLogP of 1.87, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]benzene-1,2-dicarbonitrile is sourced from PubChem (CID 107795475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).