C12H11BrN6 — CID 112736248
2-bromo-4-[(6-hydrazinyl-2-methylpyrimidin-4-yl)amino]benzonitrile (PubChem CID 112736248) has the molecular formula C12H11BrN6 and a molecular weight of 319.17 g/mol. Its IUPAC name is 2-bromo-4-[(6-hydrazinyl-2-methylpyrimidin-4-yl)amino]benzonitrile.
| Compound Name | 2-bromo-4-[(6-hydrazinyl-2-methylpyrimidin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 112736248 |
| Molecular Formula | C12H11BrN6 |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 2-bromo-4-[(6-hydrazinyl-2-methylpyrimidin-4-yl)amino]benzonitrile |
| SMILES | Cc1nc(NN)cc(Nc2ccc(C#N)c(Br)c2)n1 |
| InChI | InChI=1S/C12H11BrN6/c1-7-16-11(5-12(17-7)19-15)18-9-3-2-8(6-14)10(13)4-9/h2-5H,15H2,1H3,(H2,16,17,18,19) |
| InChIKey | COBKJACKNZFRIB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|