C13H11BrN4 — CID 112736027
4-[(4-amino-5-methyl-2-pyridinyl)amino]-2-bromobenzonitrile (PubChem CID 112736027) has the molecular formula C13H11BrN4 and a molecular weight of 303.16 g/mol. Its IUPAC name is 4-[(4-amino-5-methyl-2-pyridinyl)amino]-2-bromobenzonitrile.
| Compound Name | 4-[(4-amino-5-methyl-2-pyridinyl)amino]-2-bromobenzonitrile |
|---|---|
| PubChem CID | 112736027 |
| Molecular Formula | C13H11BrN4 |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 4-[(4-amino-5-methyl-2-pyridinyl)amino]-2-bromobenzonitrile |
| SMILES | Cc1cnc(Nc2ccc(C#N)c(Br)c2)cc1N |
| InChI | InChI=1S/C13H11BrN4/c1-8-7-17-13(5-12(8)16)18-10-3-2-9(6-15)11(14)4-10/h2-5,7H,1H3,(H3,16,17,18) |
| InChIKey | VKQBGKACHWTTRB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |