C6H4Cl2IN — CID 134221439
3,4-dichloro-N-iodoaniline (PubChem CID 134221439) has the molecular formula C6H4Cl2IN and a molecular weight of 287.92 g/mol. Its IUPAC name is 3,4-dichloro-N-iodoaniline.
| Compound Name | 3,4-dichloro-N-iodoaniline |
|---|---|
| PubChem CID | 134221439 |
| Molecular Formula | C6H4Cl2IN |
| Molecular Weight | 287.92 g/mol |
| Exact Mass | 286.88 |
| IUPAC Name | 3,4-dichloro-N-iodoaniline |
| SMILES | Clc1ccc(NI)cc1Cl |
| InChI | InChI=1S/C6H4Cl2IN/c7-5-2-1-4(10-9)3-6(5)8/h1-3,10H |
| InChIKey | UNPRNZCIOXRKOU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.92 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|