C7H6Cl2IN — CID 126576131
1-(3,4-dichlorophenyl)-N-iodomethanamine (PubChem CID 126576131) has the molecular formula C7H6Cl2IN and a molecular weight of 301.94 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-iodomethanamine.
| Compound Name | 1-(3,4-dichlorophenyl)-N-iodomethanamine |
|---|---|
| PubChem CID | 126576131 |
| Molecular Formula | C7H6Cl2IN |
| Molecular Weight | 301.94 g/mol |
| Exact Mass | 300.89 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-iodomethanamine |
| SMILES | Clc1ccc(CNI)cc1Cl |
| InChI | InChI=1S/C7H6Cl2IN/c8-6-2-1-5(4-11-10)3-7(6)9/h1-3,11H,4H2 |
| InChIKey | DEHNLRMXSVPYII-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.94 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|