C13H10Cl3N — CID 173098697
4-chloro-3-(2,5-dichlorophenyl)-N-methylaniline (PubChem CID 173098697) has the molecular formula C13H10Cl3N and a molecular weight of 286.59 g/mol. Its IUPAC name is 4-chloro-3-(2,5-dichlorophenyl)-N-methylaniline.
| Compound Name | 4-chloro-3-(2,5-dichlorophenyl)-N-methylaniline |
|---|---|
| PubChem CID | 173098697 |
| Molecular Formula | C13H10Cl3N |
| Molecular Weight | 286.59 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 4-chloro-3-(2,5-dichlorophenyl)-N-methylaniline |
| SMILES | CNc1ccc(Cl)c(-c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C13H10Cl3N/c1-17-9-3-5-13(16)11(7-9)10-6-8(14)2-4-12(10)15/h2-7,17H,1H3 |
| InChIKey | CRULRNFOXXRBCT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |