C14H14Cl2N2O — CID 178016715
3,4-dichloro-N-methylaniline;N-phenylformamide (PubChem CID 178016715) has the molecular formula C14H14Cl2N2O and a molecular weight of 297.19 g/mol. Its IUPAC name is 3,4-dichloro-N-methylaniline;N-phenylformamide.
| Compound Name | 3,4-dichloro-N-methylaniline;N-phenylformamide |
|---|---|
| PubChem CID | 178016715 |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 3,4-dichloro-N-methylaniline;N-phenylformamide |
| SMILES | CNc1ccc(Cl)c(Cl)c1.O=CNc1ccccc1 |
| InChI | InChI=1S/C7H7Cl2N.C7H7NO/c1-10-5-2-3-6(8)7(9)4-5;9-6-8-7-4-2-1-3-5-7/h2-4,10H,1H3;1-6H,(H,8,9) |
| InChIKey | GPTRWUUJCZYFDS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|