About 3,4-dichloro-N-methylaniline;N-phenylformamide
3,4-dichloro-N-methylaniline;N-phenylformamide (PubChem CID 178016715) has the molecular formula C14H14Cl2N2O
and a molecular weight of 297.19 g/mol. Its IUPAC name is 3,4-dichloro-N-methylaniline;N-phenylformamide.
Molecular Properties
| Compound Name | 3,4-dichloro-N-methylaniline;N-phenylformamide |
| PubChem CID | 178016715 |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 3,4-dichloro-N-methylaniline;N-phenylformamide |
| SMILES | CNc1ccc(Cl)c(Cl)c1.O=CNc1ccccc1 |
| InChI | InChI=1S/C7H7Cl2N.C7H7NO/c1-10-5-2-3-6(8)7(9)4-5;9-6-8-7-4-2-1-3-5-7/h2-4,10H,1H3;1-6H,(H,8,9) |
| InChIKey | GPTRWUUJCZYFDS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dichloro-N-methylaniline;N-phenylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichloro-N-methylaniline;N-phenylformamide?
The IUPAC name of 3,4-dichloro-N-methylaniline;N-phenylformamide (CID 178016715) is 3,4-dichloro-N-methylaniline;N-phenylformamide.
What is the SMILES notation for 3,4-dichloro-N-methylaniline;N-phenylformamide?
The canonical SMILES for 3,4-dichloro-N-methylaniline;N-phenylformamide is CNc1ccc(Cl)c(Cl)c1.O=CNc1ccccc1.
What is the InChIKey of 3,4-dichloro-N-methylaniline;N-phenylformamide?
The InChIKey is GPTRWUUJCZYFDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl2N.C7H7NO/c1-10-5-2-3-6(8)7(9)4-5;9-6-8-7-4-2-1-3-5-7/h2-4,10H,1H3;1-6H,(H,8,9).
What are the key properties of 3,4-dichloro-N-methylaniline;N-phenylformamide?
3,4-dichloro-N-methylaniline;N-phenylformamide has a molecular weight of 297.19 g/mol, XLogP of 4.29, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloro-N-methylaniline;N-phenylformamide is sourced from PubChem (CID 178016715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).