C18H14Cl10N4O2 — CID 88701776
N-[2,2,2-trichloro-1-(3,4-dichloroanilino)ethyl]formamide (PubChem CID 88701776) has the molecular formula C18H14Cl10N4O2 and a molecular weight of 672.87 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(3,4-dichloroanilino)ethyl]formamide.
| Compound Name | N-[2,2,2-trichloro-1-(3,4-dichloroanilino)ethyl]formamide |
|---|---|
| PubChem CID | 88701776 |
| Molecular Formula | C18H14Cl10N4O2 |
| Molecular Weight | 672.87 g/mol |
| Exact Mass | 667.80 |
| IUPAC Name | N-[2,2,2-trichloro-1-(3,4-dichloroanilino)ethyl]formamide |
| SMILES | O=CNC(Nc1ccc(Cl)c(Cl)c1)C(Cl)(Cl)Cl.O=CNC(Nc1ccc(Cl)c(Cl)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/2C9H7Cl5N2O/c2*10-6-2-1-5(3-7(6)11)16-8(15-4-17)9(12,13)14/h2*1-4,8,16H,(H,15,17) |
| InChIKey | SVFAWYHUELGZGA-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.87 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|