C14H15Cl5N2O3 — CID 2306999
[(2S)-oxolan-2-yl]methyl N-[(1S)-2,2,2-trichloro-1-(3,4-dichloroanilino)ethyl]carbamate (PubChem CID 2306999) has the molecular formula C14H15Cl5N2O3 and a molecular weight of 436.55 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl N-[(1S)-2,2,2-trichloro-1-(3,4-dichloroanilino)ethyl]carbamate.
| Compound Name | [(2S)-oxolan-2-yl]methyl N-[(1S)-2,2,2-trichloro-1-(3,4-dichloroanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 2306999 |
| Molecular Formula | C14H15Cl5N2O3 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 433.95 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl N-[(1S)-2,2,2-trichloro-1-(3,4-dichloroanilino)ethyl]carbamate |
| SMILES | O=C(N[C@H](Nc1ccc(Cl)c(Cl)c1)C(Cl)(Cl)Cl)OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H15Cl5N2O3/c15-10-4-3-8(6-11(10)16)20-12(14(17,18)19)21-13(22)24-7-9-2-1-5-23-9/h3-4,6,9,12,20H,1-2,5,7H2,(H,21,22)/t9-,12-/m0/s1 |
| InChIKey | PDFINVHQUYHSJC-CABZTGNLSA-N |
| XLogP | 5.01 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|