C19H25Cl3N2O5S — CID 2307005
ethyl 2-[[(1R)-2,2,2-trichloro-1-[[(2S)-oxolan-2-yl]methoxycarbonylamino]ethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 2307005) has the molecular formula C19H25Cl3N2O5S and a molecular weight of 499.84 g/mol. Its IUPAC name is ethyl 2-[[(1R)-2,2,2-trichloro-1-[[(2S)-oxolan-2-yl]methoxycarbonylamino]ethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(1R)-2,2,2-trichloro-1-[[(2S)-oxolan-2-yl]methoxycarbonylamino]ethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 2307005 |
| Molecular Formula | C19H25Cl3N2O5S |
| Molecular Weight | 499.84 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | ethyl 2-[[(1R)-2,2,2-trichloro-1-[[(2S)-oxolan-2-yl]methoxycarbonylamino]ethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N[C@@H](NC(=O)OC[C@@H]2CCCO2)C(Cl)(Cl)Cl)sc2c1CCCC2 |
| InChI | InChI=1S/C19H25Cl3N2O5S/c1-2-27-16(25)14-12-7-3-4-8-13(12)30-15(14)23-17(19(20,21)22)24-18(26)29-10-11-6-5-9-28-11/h11,17,23H,2-10H2,1H3,(H,24,26)/t11-,17-/m0/s1 |
| InChIKey | GCPKNNVLIKFWKV-GTNSWQLSSA-N |
| XLogP | 4.82 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.84 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|