C20H20Cl3FN2O3S — CID 5185828
ethyl 2-[[2,2,2-trichloro-1-[(4-fluorobenzoyl)amino]ethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 5185828) has the molecular formula C20H20Cl3FN2O3S and a molecular weight of 493.82 g/mol. Its IUPAC name is ethyl 2-[[2,2,2-trichloro-1-[(4-fluorobenzoyl)amino]ethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2,2,2-trichloro-1-[(4-fluorobenzoyl)amino]ethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 5185828 |
| Molecular Formula | C20H20Cl3FN2O3S |
| Molecular Weight | 493.82 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | ethyl 2-[[2,2,2-trichloro-1-[(4-fluorobenzoyl)amino]ethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(NC(=O)c2ccc(F)cc2)C(Cl)(Cl)Cl)sc2c1CCCC2 |
| InChI | InChI=1S/C20H20Cl3FN2O3S/c1-2-29-18(28)15-13-5-3-4-6-14(13)30-17(15)26-19(20(21,22)23)25-16(27)11-7-9-12(24)10-8-11/h7-10,19,26H,2-6H2,1H3,(H,25,27) |
| InChIKey | JDUWEAAJSJYWII-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.82 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|