C24H29Cl3N2O3S — CID 7024677
ethyl 2-[[(1S)-1-[(4-tert-butylbenzoyl)amino]-2,2,2-trichloroethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 7024677) has the molecular formula C24H29Cl3N2O3S and a molecular weight of 531.93 g/mol. Its IUPAC name is ethyl 2-[[(1S)-1-[(4-tert-butylbenzoyl)amino]-2,2,2-trichloroethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(1S)-1-[(4-tert-butylbenzoyl)amino]-2,2,2-trichloroethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 7024677 |
| Molecular Formula | C24H29Cl3N2O3S |
| Molecular Weight | 531.93 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | ethyl 2-[[(1S)-1-[(4-tert-butylbenzoyl)amino]-2,2,2-trichloroethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N[C@H](NC(=O)c2ccc(C(C)(C)C)cc2)C(Cl)(Cl)Cl)sc2c1CCCC2 |
| InChI | InChI=1S/C24H29Cl3N2O3S/c1-5-32-21(31)18-16-8-6-7-9-17(16)33-20(18)29-22(24(25,26)27)28-19(30)14-10-12-15(13-11-14)23(2,3)4/h10-13,22,29H,5-9H2,1-4H3,(H,28,30)/t22-/m0/s1 |
| InChIKey | XZVIKQYPUZZSHW-QFIPXVFZSA-N |
| XLogP | 6.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.93 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|