C17H23Cl3N2O3S — CID 3772366
methyl 2-[[2,2,2-trichloro-1-(2,2-dimethylpropanoylamino)ethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3772366) has the molecular formula C17H23Cl3N2O3S and a molecular weight of 441.81 g/mol. Its IUPAC name is methyl 2-[[2,2,2-trichloro-1-(2,2-dimethylpropanoylamino)ethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2,2,2-trichloro-1-(2,2-dimethylpropanoylamino)ethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3772366 |
| Molecular Formula | C17H23Cl3N2O3S |
| Molecular Weight | 441.81 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | methyl 2-[[2,2,2-trichloro-1-(2,2-dimethylpropanoylamino)ethyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(NC(=O)C(C)(C)C)C(Cl)(Cl)Cl)sc2c1CCCC2 |
| InChI | InChI=1S/C17H23Cl3N2O3S/c1-16(2,3)15(24)22-14(17(18,19)20)21-12-11(13(23)25-4)9-7-5-6-8-10(9)26-12/h14,21H,5-8H2,1-4H3,(H,22,24) |
| InChIKey | GBFDKBILVBSGJC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.81 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|