C15H19Cl3N2O3S — CID 6581303
methyl 2-[[(1R)-2,2,2-trichloro-1-(2-methylpropanoylamino)ethyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 6581303) has the molecular formula C15H19Cl3N2O3S and a molecular weight of 413.75 g/mol. Its IUPAC name is methyl 2-[[(1R)-2,2,2-trichloro-1-(2-methylpropanoylamino)ethyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[(1R)-2,2,2-trichloro-1-(2-methylpropanoylamino)ethyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 6581303 |
| Molecular Formula | C15H19Cl3N2O3S |
| Molecular Weight | 413.75 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | methyl 2-[[(1R)-2,2,2-trichloro-1-(2-methylpropanoylamino)ethyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N[C@@H](NC(=O)C(C)C)C(Cl)(Cl)Cl)sc2c1CCC2 |
| InChI | InChI=1S/C15H19Cl3N2O3S/c1-7(2)11(21)19-14(15(16,17)18)20-12-10(13(22)23-3)8-5-4-6-9(8)24-12/h7,14,20H,4-6H2,1-3H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | MSFNFFYSKMPWAH-CQSZACIVSA-N |
| XLogP | 3.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.75 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|