C18H26Cl3N3O5S — CID 34064069
[(2S)-oxolan-2-yl]methyl N-[(1S)-2,2,2-trichloro-1-[3-(diethylsulfamoyl)anilino]ethyl]carbamate (PubChem CID 34064069) has the molecular formula C18H26Cl3N3O5S and a molecular weight of 502.85 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl N-[(1S)-2,2,2-trichloro-1-[3-(diethylsulfamoyl)anilino]ethyl]carbamate.
| Compound Name | [(2S)-oxolan-2-yl]methyl N-[(1S)-2,2,2-trichloro-1-[3-(diethylsulfamoyl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 34064069 |
| Molecular Formula | C18H26Cl3N3O5S |
| Molecular Weight | 502.85 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl N-[(1S)-2,2,2-trichloro-1-[3-(diethylsulfamoyl)anilino]ethyl]carbamate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(N[C@@H](NC(=O)OC[C@@H]2CCCO2)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C18H26Cl3N3O5S/c1-3-24(4-2)30(26,27)15-9-5-7-13(11-15)22-16(18(19,20)21)23-17(25)29-12-14-8-6-10-28-14/h5,7,9,11,14,16,22H,3-4,6,8,10,12H2,1-2H3,(H,23,25)/t14-,16-/m0/s1 |
| InChIKey | JNJPDHZJXJKUFK-HOCLYGCPSA-N |
| XLogP | 3.73 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|