C16H21Cl3N2O4 — CID 2306988
[(2R)-oxolan-2-yl]methyl N-[(1R)-2,2,2-trichloro-1-(4-ethoxyanilino)ethyl]carbamate (PubChem CID 2306988) has the molecular formula C16H21Cl3N2O4 and a molecular weight of 411.71 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl N-[(1R)-2,2,2-trichloro-1-(4-ethoxyanilino)ethyl]carbamate.
| Compound Name | [(2R)-oxolan-2-yl]methyl N-[(1R)-2,2,2-trichloro-1-(4-ethoxyanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 2306988 |
| Molecular Formula | C16H21Cl3N2O4 |
| Molecular Weight | 411.71 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl N-[(1R)-2,2,2-trichloro-1-(4-ethoxyanilino)ethyl]carbamate |
| SMILES | CCOc1ccc(N[C@H](NC(=O)OC[C@H]2CCCO2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H21Cl3N2O4/c1-2-23-12-7-5-11(6-8-12)20-14(16(17,18)19)21-15(22)25-10-13-4-3-9-24-13/h5-8,13-14,20H,2-4,9-10H2,1H3,(H,21,22)/t13-,14-/m1/s1 |
| InChIKey | DBRCGOITNBIEKS-ZIAGYGMSSA-N |
| XLogP | 4.10 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.71 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|