C16H18Cl3N3O4S — CID 2306994
[(2S)-oxolan-2-yl]methyl N-[(1S)-2,2,2-trichloro-1-[(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl]carbamate (PubChem CID 2306994) has the molecular formula C16H18Cl3N3O4S and a molecular weight of 454.76 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl N-[(1S)-2,2,2-trichloro-1-[(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl]carbamate.
| Compound Name | [(2S)-oxolan-2-yl]methyl N-[(1S)-2,2,2-trichloro-1-[(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 2306994 |
| Molecular Formula | C16H18Cl3N3O4S |
| Molecular Weight | 454.76 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl N-[(1S)-2,2,2-trichloro-1-[(6-methoxy-1,3-benzothiazol-2-yl)amino]ethyl]carbamate |
| SMILES | COc1ccc2nc(N[C@H](NC(=O)OC[C@@H]3CCCO3)C(Cl)(Cl)Cl)sc2c1 |
| InChI | InChI=1S/C16H18Cl3N3O4S/c1-24-9-4-5-11-12(7-9)27-14(20-11)21-13(16(17,18)19)22-15(23)26-8-10-3-2-6-25-10/h4-5,7,10,13H,2-3,6,8H2,1H3,(H,20,21)(H,22,23)/t10-,13+/m0/s1 |
| InChIKey | SLXYBOIPZUJNGQ-GXFFZTMASA-N |
| XLogP | 4.32 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.76 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|