C14H18N2O2S — CID 79518210
6-methoxy-N-[2-(oxolan-2-yl)ethyl]-1,3-benzothiazol-2-amine (PubChem CID 79518210) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 6-methoxy-N-[2-(oxolan-2-yl)ethyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-methoxy-N-[2-(oxolan-2-yl)ethyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79518210 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 6-methoxy-N-[2-(oxolan-2-yl)ethyl]-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2nc(NCCC3CCCO3)sc2c1 |
| InChI | InChI=1S/C14H18N2O2S/c1-17-11-4-5-12-13(9-11)19-14(16-12)15-7-6-10-3-2-8-18-10/h4-5,9-10H,2-3,6-8H2,1H3,(H,15,16) |
| InChIKey | VOILBYUDYXTIDL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |