C15H19N3O3S — CID 95157998
1-(6-methoxy-1,3-benzothiazol-2-yl)-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea (PubChem CID 95157998) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-(6-methoxy-1,3-benzothiazol-2-yl)-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea.
| Compound Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 95157998 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)-3-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]urea |
| SMILES | COc1ccc2nc(NC(=O)N[C@@H](C)[C@@H]3CCCO3)sc2c1 |
| InChI | InChI=1S/C15H19N3O3S/c1-9(12-4-3-7-21-12)16-14(19)18-15-17-11-6-5-10(20-2)8-13(11)22-15/h5-6,8-9,12H,3-4,7H2,1-2H3,(H2,16,17,18,19)/t9-,12-/m0/s1 |
| InChIKey | HGTMMAIOHCMZHB-CABZTGNLSA-N |
| XLogP | 2.99 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |