C22H19Cl3N2O5 — CID 34064065
[(2R)-oxolan-2-yl]methyl N-[(1R)-2,2,2-trichloro-1-[(9,10-dioxoanthracen-2-yl)amino]ethyl]carbamate (PubChem CID 34064065) has the molecular formula C22H19Cl3N2O5 and a molecular weight of 497.76 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl N-[(1R)-2,2,2-trichloro-1-[(9,10-dioxoanthracen-2-yl)amino]ethyl]carbamate.
| Compound Name | [(2R)-oxolan-2-yl]methyl N-[(1R)-2,2,2-trichloro-1-[(9,10-dioxoanthracen-2-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 34064065 |
| Molecular Formula | C22H19Cl3N2O5 |
| Molecular Weight | 497.76 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl N-[(1R)-2,2,2-trichloro-1-[(9,10-dioxoanthracen-2-yl)amino]ethyl]carbamate |
| SMILES | O=C(N[C@@H](Nc1ccc2c(c1)C(=O)c1ccccc1C2=O)C(Cl)(Cl)Cl)OC[C@H]1CCCO1 |
| InChI | InChI=1S/C22H19Cl3N2O5/c23-22(24,25)20(27-21(30)32-11-13-4-3-9-31-13)26-12-7-8-16-17(10-12)19(29)15-6-2-1-5-14(15)18(16)28/h1-2,5-8,10,13,20,26H,3-4,9,11H2,(H,27,30)/t13-,20-/m1/s1 |
| InChIKey | RIWCCQGAVVTPRF-ZUOKHONESA-N |
| XLogP | 4.48 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.76 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|