C9H9Cl5N2O2 — CID 159594443
N-(3,4-dichlorophenyl)hydroxylamine;N-(2,2,2-trichloroethyl)formamide (PubChem CID 159594443) has the molecular formula C9H9Cl5N2O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)hydroxylamine;N-(2,2,2-trichloroethyl)formamide.
| Compound Name | N-(3,4-dichlorophenyl)hydroxylamine;N-(2,2,2-trichloroethyl)formamide |
|---|---|
| PubChem CID | 159594443 |
| Molecular Formula | C9H9Cl5N2O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | N-(3,4-dichlorophenyl)hydroxylamine;N-(2,2,2-trichloroethyl)formamide |
| SMILES | O=CNCC(Cl)(Cl)Cl.ONc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H5Cl2NO.C3H4Cl3NO/c7-5-2-1-4(9-10)3-6(5)8;4-3(5,6)1-7-2-8/h1-3,9-10H;2H,1H2,(H,7,8) |
| InChIKey | MKQQRKSYWKVGQI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|