C12H11ClN6 — CID 166380400
5-chloro-2-N-(1H-indazol-5-yl)-4-N-methylpyrimidine-2,4-diamine (PubChem CID 166380400) has the molecular formula C12H11ClN6 and a molecular weight of 274.72 g/mol. Its IUPAC name is 5-chloro-2-N-(1H-indazol-5-yl)-4-N-methylpyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-(1H-indazol-5-yl)-4-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166380400 |
| Molecular Formula | C12H11ClN6 |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 5-chloro-2-N-(1H-indazol-5-yl)-4-N-methylpyrimidine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccc3[nH]ncc3c2)ncc1Cl |
| InChI | InChI=1S/C12H11ClN6/c1-14-11-9(13)6-15-12(18-11)17-8-2-3-10-7(4-8)5-16-19-10/h2-6H,1H3,(H,16,19)(H2,14,15,17,18) |
| InChIKey | HERLUFQNRFDANK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |