C13H12FN5 — CID 133416322
N-(6-ethyl-5-fluoropyrimidin-4-yl)-1H-indazol-5-amine (PubChem CID 133416322) has the molecular formula C13H12FN5 and a molecular weight of 257.27 g/mol. Its IUPAC name is N-(6-ethyl-5-fluoropyrimidin-4-yl)-1H-indazol-5-amine.
| Compound Name | N-(6-ethyl-5-fluoropyrimidin-4-yl)-1H-indazol-5-amine |
|---|---|
| PubChem CID | 133416322 |
| Molecular Formula | C13H12FN5 |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-(6-ethyl-5-fluoropyrimidin-4-yl)-1H-indazol-5-amine |
| SMILES | CCc1ncnc(Nc2ccc3[nH]ncc3c2)c1F |
| InChI | InChI=1S/C13H12FN5/c1-2-10-12(14)13(16-7-15-10)18-9-3-4-11-8(5-9)6-17-19-11/h3-7H,2H2,1H3,(H,17,19)(H,15,16,18) |
| InChIKey | KHLAGTRIMCFFCF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |