About N-(1H-indazol-5-yl)-[1,3]thiazolo[5,4-d]pyrimidin-7-amine
N-(1H-indazol-5-yl)-[1,3]thiazolo[5,4-d]pyrimidin-7-amine (PubChem CID 78324014) has the molecular formula C12H8N6S
and a molecular weight of 268.31 g/mol. Its IUPAC name is N-(1H-indazol-5-yl)-[1,3]thiazolo[5,4-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | N-(1H-indazol-5-yl)-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
| PubChem CID | 78324014 |
| Molecular Formula | C12H8N6S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | N-(1H-indazol-5-yl)-[1,3]thiazolo[5,4-d]pyrimidin-7-amine |
| SMILES | c1nc(Nc2ccc3[nH]ncc3c2)c2ncsc2n1 |
| InChI | InChI=1S/C12H8N6S/c1-2-9-7(4-16-18-9)3-8(1)17-11-10-12(14-5-13-11)19-6-15-10/h1-6H,(H,16,18)(H,13,14,17) |
| InChIKey | WEGGSUIYJJSKGU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(1H-indazol-5-yl)-[1,3]thiazolo[5,4-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-indazol-5-yl)-[1,3]thiazolo[5,4-d]pyrimidin-7-amine?
The IUPAC name of N-(1H-indazol-5-yl)-[1,3]thiazolo[5,4-d]pyrimidin-7-amine (CID 78324014) is N-(1H-indazol-5-yl)-[1,3]thiazolo[5,4-d]pyrimidin-7-amine.
What is the SMILES notation for N-(1H-indazol-5-yl)-[1,3]thiazolo[5,4-d]pyrimidin-7-amine?
The canonical SMILES for N-(1H-indazol-5-yl)-[1,3]thiazolo[5,4-d]pyrimidin-7-amine is c1nc(Nc2ccc3[nH]ncc3c2)c2ncsc2n1.
What is the InChIKey of N-(1H-indazol-5-yl)-[1,3]thiazolo[5,4-d]pyrimidin-7-amine?
The InChIKey is WEGGSUIYJJSKGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N6S/c1-2-9-7(4-16-18-9)3-8(1)17-11-10-12(14-5-13-11)19-6-15-10/h1-6H,(H,16,18)(H,13,14,17).
What are the key properties of N-(1H-indazol-5-yl)-[1,3]thiazolo[5,4-d]pyrimidin-7-amine?
N-(1H-indazol-5-yl)-[1,3]thiazolo[5,4-d]pyrimidin-7-amine has a molecular weight of 268.31 g/mol, XLogP of 2.71, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-indazol-5-yl)-[1,3]thiazolo[5,4-d]pyrimidin-7-amine is sourced from PubChem (CID 78324014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).