C14H15FN4O — CID 133418630
2-[4-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]phenyl]acetamide (PubChem CID 133418630) has the molecular formula C14H15FN4O and a molecular weight of 274.30 g/mol. Its IUPAC name is 2-[4-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]phenyl]acetamide.
| Compound Name | 2-[4-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 133418630 |
| Molecular Formula | C14H15FN4O |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-[4-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]phenyl]acetamide |
| SMILES | CCc1ncnc(Nc2ccc(CC(N)=O)cc2)c1F |
| InChI | InChI=1S/C14H15FN4O/c1-2-11-13(15)14(18-8-17-11)19-10-5-3-9(4-6-10)7-12(16)20/h3-6,8H,2,7H2,1H3,(H2,16,20)(H,17,18,19) |
| InChIKey | AZUYDQLBBQMDFX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |