C18H17FN4O2 — CID 133433194
N-[4-[[(6-ethyl-5-fluoropyrimidin-4-yl)amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 133433194) has the molecular formula C18H17FN4O2 and a molecular weight of 340.36 g/mol. Its IUPAC name is N-[4-[[(6-ethyl-5-fluoropyrimidin-4-yl)amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[(6-ethyl-5-fluoropyrimidin-4-yl)amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 133433194 |
| Molecular Formula | C18H17FN4O2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-[4-[[(6-ethyl-5-fluoropyrimidin-4-yl)amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | CCc1ncnc(NCc2ccc(NC(=O)c3ccco3)cc2)c1F |
| InChI | InChI=1S/C18H17FN4O2/c1-2-14-16(19)17(22-11-21-14)20-10-12-5-7-13(8-6-12)23-18(24)15-4-3-9-25-15/h3-9,11H,2,10H2,1H3,(H,23,24)(H,20,21,22) |
| InChIKey | XUTXGZQBJOUFNM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |