C19H17F2N3O — CID 146094050
6-ethyl-5-fluoro-N-[[4-(4-fluorophenoxy)phenyl]methyl]pyrimidin-4-amine (PubChem CID 146094050) has the molecular formula C19H17F2N3O and a molecular weight of 341.36 g/mol. Its IUPAC name is 6-ethyl-5-fluoro-N-[[4-(4-fluorophenoxy)phenyl]methyl]pyrimidin-4-amine.
| Compound Name | 6-ethyl-5-fluoro-N-[[4-(4-fluorophenoxy)phenyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146094050 |
| Molecular Formula | C19H17F2N3O |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 6-ethyl-5-fluoro-N-[[4-(4-fluorophenoxy)phenyl]methyl]pyrimidin-4-amine |
| SMILES | CCc1ncnc(NCc2ccc(Oc3ccc(F)cc3)cc2)c1F |
| InChI | InChI=1S/C19H17F2N3O/c1-2-17-18(21)19(24-12-23-17)22-11-13-3-7-15(8-4-13)25-16-9-5-14(20)6-10-16/h3-10,12H,2,11H2,1H3,(H,22,23,24) |
| InChIKey | NFXNLVMZCMGKJQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |