C16H21FN4O — CID 133422610
6-ethyl-5-fluoro-N-[[2-[(2-methylpropan-2-yl)oxy]-4-pyridinyl]methyl]pyrimidin-4-amine (PubChem CID 133422610) has the molecular formula C16H21FN4O and a molecular weight of 304.37 g/mol. Its IUPAC name is 6-ethyl-5-fluoro-N-[[2-[(2-methylpropan-2-yl)oxy]-4-pyridinyl]methyl]pyrimidin-4-amine.
| Compound Name | 6-ethyl-5-fluoro-N-[[2-[(2-methylpropan-2-yl)oxy]-4-pyridinyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133422610 |
| Molecular Formula | C16H21FN4O |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 6-ethyl-5-fluoro-N-[[2-[(2-methylpropan-2-yl)oxy]-4-pyridinyl]methyl]pyrimidin-4-amine |
| SMILES | CCc1ncnc(NCc2ccnc(OC(C)(C)C)c2)c1F |
| InChI | InChI=1S/C16H21FN4O/c1-5-12-14(17)15(21-10-20-12)19-9-11-6-7-18-13(8-11)22-16(2,3)4/h6-8,10H,5,9H2,1-4H3,(H,19,20,21) |
| InChIKey | HKKMGFWABOTPFS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |