2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid

C12H9Cl2N3O2 — CID 83182017

IUPAC2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid
SMILESCc1nc(Nc2ccc(Cl)c(Cl)c2)ncc1C(=O)O
InChIInChI=1S/C12H9Cl2N3O2/c1-6-8(11(18)19)5-15-12(16-6)17-7-2-3-9(13)10(14)4-7/h2-5H,1H3,(H,18,19)(H,15,16,17)
InChIKeyVDTUBABRAXIVFL-UHFFFAOYSA-N
MW298.13 g/mol
LogP3.53
Rot. Bonds3

About 2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid

2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid (PubChem CID 83182017) has the molecular formula C12H9Cl2N3O2 and a molecular weight of 298.13 g/mol. Its IUPAC name is 2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid.

Molecular Properties

Compound Name2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid
PubChem CID83182017
Molecular FormulaC12H9Cl2N3O2
Molecular Weight298.13 g/mol
Exact Mass297.01
IUPAC Name2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid
SMILESCc1nc(Nc2ccc(Cl)c(Cl)c2)ncc1C(=O)O
InChIInChI=1S/C12H9Cl2N3O2/c1-6-8(11(18)19)5-15-12(16-6)17-7-2-3-9(13)10(14)4-7/h2-5H,1H3,(H,18,19)(H,15,16,17)
InChIKeyVDTUBABRAXIVFL-UHFFFAOYSA-N
XLogP3.53
TPSA75.11 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.13
LogP ≤ 53.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid?
The IUPAC name of 2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid (CID 83182017) is 2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid.
What is the SMILES notation for 2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid?
The canonical SMILES for 2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid is Cc1nc(Nc2ccc(Cl)c(Cl)c2)ncc1C(=O)O.
What is the InChIKey of 2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid?
The InChIKey is VDTUBABRAXIVFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl2N3O2/c1-6-8(11(18)19)5-15-12(16-6)17-7-2-3-9(13)10(14)4-7/h2-5H,1H3,(H,18,19)(H,15,16,17).
What are the key properties of 2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid?
2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid has a molecular weight of 298.13 g/mol, XLogP of 3.53, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichloroanilino)-4-methylpyrimidine-5-carboxylic acid is sourced from PubChem (CID 83182017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).