C13H9ClF3N3O2 — CID 68620191
2-(4-chloro-3-methylanilino)-4-(trifluoromethyl)pyrimidine-5-carboxylic acid (PubChem CID 68620191) has the molecular formula C13H9ClF3N3O2 and a molecular weight of 331.68 g/mol. Its IUPAC name is 2-(4-chloro-3-methylanilino)-4-(trifluoromethyl)pyrimidine-5-carboxylic acid.
| Compound Name | 2-(4-chloro-3-methylanilino)-4-(trifluoromethyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 68620191 |
| Molecular Formula | C13H9ClF3N3O2 |
| Molecular Weight | 331.68 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-(4-chloro-3-methylanilino)-4-(trifluoromethyl)pyrimidine-5-carboxylic acid |
| SMILES | Cc1cc(Nc2ncc(C(=O)O)c(C(F)(F)F)n2)ccc1Cl |
| InChI | InChI=1S/C13H9ClF3N3O2/c1-6-4-7(2-3-9(6)14)19-12-18-5-8(11(21)22)10(20-12)13(15,16)17/h2-5H,1H3,(H,21,22)(H,18,19,20) |
| InChIKey | WFLPPNWVIUGQAI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.68 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |