C13H6ClF6N3O2 — CID 87518431
2-[2-chloro-4-(trifluoromethyl)anilino]-4-(trifluoromethyl)pyrimidine-5-carboxylic acid (PubChem CID 87518431) has the molecular formula C13H6ClF6N3O2 and a molecular weight of 385.65 g/mol. Its IUPAC name is 2-[2-chloro-4-(trifluoromethyl)anilino]-4-(trifluoromethyl)pyrimidine-5-carboxylic acid.
| Compound Name | 2-[2-chloro-4-(trifluoromethyl)anilino]-4-(trifluoromethyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 87518431 |
| Molecular Formula | C13H6ClF6N3O2 |
| Molecular Weight | 385.65 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 2-[2-chloro-4-(trifluoromethyl)anilino]-4-(trifluoromethyl)pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(Nc2ccc(C(F)(F)F)cc2Cl)nc1C(F)(F)F |
| InChI | InChI=1S/C13H6ClF6N3O2/c14-7-3-5(12(15,16)17)1-2-8(7)22-11-21-4-6(10(24)25)9(23-11)13(18,19)20/h1-4H,(H,24,25)(H,21,22,23) |
| InChIKey | HORVJUWEDVVEAA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |