C12H11F2N3O2S — CID 61283007
1-(2,4-difluoro-5-nitrophenyl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]methanamine (PubChem CID 61283007) has the molecular formula C12H11F2N3O2S and a molecular weight of 299.30 g/mol. Its IUPAC name is 1-(2,4-difluoro-5-nitrophenyl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]methanamine.
| Compound Name | 1-(2,4-difluoro-5-nitrophenyl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 61283007 |
| Molecular Formula | C12H11F2N3O2S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 1-(2,4-difluoro-5-nitrophenyl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]methanamine |
| SMILES | Cc1nc(CNCc2cc([N+](=O)[O-])c(F)cc2F)cs1 |
| InChI | InChI=1S/C12H11F2N3O2S/c1-7-16-9(6-20-7)5-15-4-8-2-12(17(18)19)11(14)3-10(8)13/h2-3,6,15H,4-5H2,1H3 |
| InChIKey | WIXOCTCGTOOODE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|