C11H10N4O4S — CID 47230333
N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,4-dinitroaniline (PubChem CID 47230333) has the molecular formula C11H10N4O4S and a molecular weight of 294.29 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,4-dinitroaniline.
| Compound Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 47230333 |
| Molecular Formula | C11H10N4O4S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,4-dinitroaniline |
| SMILES | Cc1nc(CNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C11H10N4O4S/c1-7-13-8(6-20-7)5-12-10-3-2-9(14(16)17)4-11(10)15(18)19/h2-4,6,12H,5H2,1H3 |
| InChIKey | SZIPUMFLLIVHMD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|