C12H10F2N2O2S — CID 63248342
N-[(2,4-difluoro-5-nitrophenyl)methyl]-1-thiophen-3-ylmethanamine (PubChem CID 63248342) has the molecular formula C12H10F2N2O2S and a molecular weight of 284.29 g/mol. Its IUPAC name is N-[(2,4-difluoro-5-nitrophenyl)methyl]-1-thiophen-3-ylmethanamine.
| Compound Name | N-[(2,4-difluoro-5-nitrophenyl)methyl]-1-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 63248342 |
| Molecular Formula | C12H10F2N2O2S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | N-[(2,4-difluoro-5-nitrophenyl)methyl]-1-thiophen-3-ylmethanamine |
| SMILES | O=[N+]([O-])c1cc(CNCc2ccsc2)c(F)cc1F |
| InChI | InChI=1S/C12H10F2N2O2S/c13-10-4-11(14)12(16(17)18)3-9(10)6-15-5-8-1-2-19-7-8/h1-4,7,15H,5-6H2 |
| InChIKey | XVDRIKHTEKDATJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|