C14H15ClF3N3O3 — CID 133285407
1-[4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one (PubChem CID 133285407) has the molecular formula C14H15ClF3N3O3 and a molecular weight of 365.74 g/mol. Its IUPAC name is 1-[4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 133285407 |
| Molecular Formula | C14H15ClF3N3O3 |
| Molecular Weight | 365.74 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 1-[4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(c2cc(Cl)c(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H15ClF3N3O3/c1-2-13(22)20-5-3-19(4-6-20)11-8-10(15)9(14(16,17)18)7-12(11)21(23)24/h7-8H,2-6H2,1H3 |
| InChIKey | LGBJNEGYAJAKBY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.74 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|