C16H15ClF3N3O4S2 — CID 26448864
1-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-4-(5-methylthiophen-2-yl)sulfonylpiperazine (PubChem CID 26448864) has the molecular formula C16H15ClF3N3O4S2 and a molecular weight of 469.89 g/mol. Its IUPAC name is 1-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-4-(5-methylthiophen-2-yl)sulfonylpiperazine.
| Compound Name | 1-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-4-(5-methylthiophen-2-yl)sulfonylpiperazine |
|---|---|
| PubChem CID | 26448864 |
| Molecular Formula | C16H15ClF3N3O4S2 |
| Molecular Weight | 469.89 g/mol |
| Exact Mass | 469.01 |
| IUPAC Name | 1-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]-4-(5-methylthiophen-2-yl)sulfonylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3cc(Cl)c(C(F)(F)F)cc3[N+](=O)[O-])CC2)s1 |
| InChI | InChI=1S/C16H15ClF3N3O4S2/c1-10-2-3-15(28-10)29(26,27)22-6-4-21(5-7-22)13-9-12(17)11(16(18,19)20)8-14(13)23(24)25/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | FOGVVXLSZOFQEX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.89 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|