C18H16ClF3N2O4S — CID 139507437
1-[5-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-2-nitrophenyl]piperidine (PubChem CID 139507437) has the molecular formula C18H16ClF3N2O4S and a molecular weight of 448.85 g/mol. Its IUPAC name is 1-[5-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-2-nitrophenyl]piperidine.
| Compound Name | 1-[5-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-2-nitrophenyl]piperidine |
|---|---|
| PubChem CID | 139507437 |
| Molecular Formula | C18H16ClF3N2O4S |
| Molecular Weight | 448.85 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 1-[5-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-2-nitrophenyl]piperidine |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)cc1N1CCCCC1 |
| InChI | InChI=1S/C18H16ClF3N2O4S/c19-15-6-4-12(10-14(15)18(20,21)22)29(27,28)13-5-7-16(24(25)26)17(11-13)23-8-2-1-3-9-23/h4-7,10-11H,1-3,8-9H2 |
| InChIKey | LLCDEFQWBSNEML-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.85 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|