C17H13ClF3N5O2S — CID 112814914
4-[4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]thieno[2,3-d]pyrimidine (PubChem CID 112814914) has the molecular formula C17H13ClF3N5O2S and a molecular weight of 443.84 g/mol. Its IUPAC name is 4-[4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]thieno[2,3-d]pyrimidine.
| Compound Name | 4-[4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 112814914 |
| Molecular Formula | C17H13ClF3N5O2S |
| Molecular Weight | 443.84 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 4-[4-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]thieno[2,3-d]pyrimidine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(Cl)cc1N1CCN(c2ncnc3sccc23)CC1 |
| InChI | InChI=1S/C17H13ClF3N5O2S/c18-12-8-13(14(26(27)28)7-11(12)17(19,20)21)24-2-4-25(5-3-24)15-10-1-6-29-16(10)23-9-22-15/h1,6-9H,2-5H2 |
| InChIKey | FDZVHTDKNHFBCO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.84 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|