C18H19N5O3S — CID 133350757
4-[4-(3-ethoxy-4-nitrophenyl)piperazin-1-yl]thieno[2,3-d]pyrimidine (PubChem CID 133350757) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is 4-[4-(3-ethoxy-4-nitrophenyl)piperazin-1-yl]thieno[2,3-d]pyrimidine.
| Compound Name | 4-[4-(3-ethoxy-4-nitrophenyl)piperazin-1-yl]thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 133350757 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-[4-(3-ethoxy-4-nitrophenyl)piperazin-1-yl]thieno[2,3-d]pyrimidine |
| SMILES | CCOc1cc(N2CCN(c3ncnc4sccc34)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N5O3S/c1-2-26-16-11-13(3-4-15(16)23(24)25)21-6-8-22(9-7-21)17-14-5-10-27-18(14)20-12-19-17/h3-5,10-12H,2,6-9H2,1H3 |
| InChIKey | YTOLLZFLGNEISS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|