C16H15N5O4S2 — CID 35885094
4-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]thieno[2,3-d]pyrimidine (PubChem CID 35885094) has the molecular formula C16H15N5O4S2 and a molecular weight of 405.46 g/mol. Its IUPAC name is 4-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]thieno[2,3-d]pyrimidine.
| Compound Name | 4-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 35885094 |
| Molecular Formula | C16H15N5O4S2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 4-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]thieno[2,3-d]pyrimidine |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N1CCN(c2ncnc3sccc23)CC1 |
| InChI | InChI=1S/C16H15N5O4S2/c22-21(23)13-3-1-2-4-14(13)27(24,25)20-8-6-19(7-9-20)15-12-5-10-26-16(12)18-11-17-15/h1-5,10-11H,6-9H2 |
| InChIKey | CSGMBFAKOLVEGD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 109.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|