C18H17N5O3S2 — CID 112814637
(5-methylsulfanyl-2-nitrophenyl)-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methanone (PubChem CID 112814637) has the molecular formula C18H17N5O3S2 and a molecular weight of 415.50 g/mol. Its IUPAC name is (5-methylsulfanyl-2-nitrophenyl)-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methanone.
| Compound Name | (5-methylsulfanyl-2-nitrophenyl)-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 112814637 |
| Molecular Formula | C18H17N5O3S2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | (5-methylsulfanyl-2-nitrophenyl)-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methanone |
| SMILES | CSc1ccc([N+](=O)[O-])c(C(=O)N2CCN(c3ncnc4sccc34)CC2)c1 |
| InChI | InChI=1S/C18H17N5O3S2/c1-27-12-2-3-15(23(25)26)14(10-12)18(24)22-7-5-21(6-8-22)16-13-4-9-28-17(13)20-11-19-16/h2-4,9-11H,5-8H2,1H3 |
| InChIKey | WBYATZWAPFCUHE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|