C19H26N2O2S2 — CID 113076523
1-(2-tert-butylphenyl)-4-(5-methylthiophen-2-yl)sulfonylpiperazine (PubChem CID 113076523) has the molecular formula C19H26N2O2S2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 1-(2-tert-butylphenyl)-4-(5-methylthiophen-2-yl)sulfonylpiperazine.
| Compound Name | 1-(2-tert-butylphenyl)-4-(5-methylthiophen-2-yl)sulfonylpiperazine |
|---|---|
| PubChem CID | 113076523 |
| Molecular Formula | C19H26N2O2S2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-(2-tert-butylphenyl)-4-(5-methylthiophen-2-yl)sulfonylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3ccccc3C(C)(C)C)CC2)s1 |
| InChI | InChI=1S/C19H26N2O2S2/c1-15-9-10-18(24-15)25(22,23)21-13-11-20(12-14-21)17-8-6-5-7-16(17)19(2,3)4/h5-10H,11-14H2,1-4H3 |
| InChIKey | DJQGEXSCIIEXJK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |