C16H16ClF3N6O3 — CID 100758338
5-amino-1-[1-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]imidazole-4-carboxamide (PubChem CID 100758338) has the molecular formula C16H16ClF3N6O3 and a molecular weight of 432.79 g/mol. Its IUPAC name is 5-amino-1-[1-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]imidazole-4-carboxamide.
| Compound Name | 5-amino-1-[1-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 100758338 |
| Molecular Formula | C16H16ClF3N6O3 |
| Molecular Weight | 432.79 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 5-amino-1-[1-[5-chloro-2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-yl]imidazole-4-carboxamide |
| SMILES | NC(=O)c1ncn(C2CCN(c3cc(Cl)c(C(F)(F)F)cc3[N+](=O)[O-])CC2)c1N |
| InChI | InChI=1S/C16H16ClF3N6O3/c17-10-6-11(12(26(28)29)5-9(10)16(18,19)20)24-3-1-8(2-4-24)25-7-23-13(14(25)21)15(22)27/h5-8H,1-4,21H2,(H2,22,27) |
| InChIKey | PHQWUNLETRAGDT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.79 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|