C18H24N6O4 — CID 100758332
5-amino-1-[1-(4-nitro-3-propan-2-yloxyphenyl)piperidin-4-yl]imidazole-4-carboxamide (PubChem CID 100758332) has the molecular formula C18H24N6O4 and a molecular weight of 388.43 g/mol. Its IUPAC name is 5-amino-1-[1-(4-nitro-3-propan-2-yloxyphenyl)piperidin-4-yl]imidazole-4-carboxamide.
| Compound Name | 5-amino-1-[1-(4-nitro-3-propan-2-yloxyphenyl)piperidin-4-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 100758332 |
| Molecular Formula | C18H24N6O4 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 5-amino-1-[1-(4-nitro-3-propan-2-yloxyphenyl)piperidin-4-yl]imidazole-4-carboxamide |
| SMILES | CC(C)Oc1cc(N2CCC(n3cnc(C(N)=O)c3N)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H24N6O4/c1-11(2)28-15-9-13(3-4-14(15)24(26)27)22-7-5-12(6-8-22)23-10-21-16(17(23)19)18(20)25/h3-4,9-12H,5-8,19H2,1-2H3,(H2,20,25) |
| InChIKey | YJLWRUUPRXZOAK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 142.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|