C17H22N4O4 — CID 133395715
[1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]-(1-methylimidazol-2-yl)methanol (PubChem CID 133395715) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is [1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]-(1-methylimidazol-2-yl)methanol.
| Compound Name | [1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]-(1-methylimidazol-2-yl)methanol |
|---|---|
| PubChem CID | 133395715 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | [1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]-(1-methylimidazol-2-yl)methanol |
| SMILES | COc1cc(N2CCC(C(O)c3nccn3C)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22N4O4/c1-19-10-7-18-17(19)16(22)12-5-8-20(9-6-12)13-3-4-14(21(23)24)15(11-13)25-2/h3-4,7,10-12,16,22H,5-6,8-9H2,1-2H3 |
| InChIKey | MCEYMNQWWPPBQU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 93.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|