C19H28N4O11 — CID 145316960
acetylene;1-[1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]-4-methylpiperazine-2,2,3,3,5,5,6,6-octol (PubChem CID 145316960) has the molecular formula C19H28N4O11 and a molecular weight of 488.45 g/mol. Its IUPAC name is acetylene;1-[1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]-4-methylpiperazine-2,2,3,3,5,5,6,6-octol.
| Compound Name | acetylene;1-[1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]-4-methylpiperazine-2,2,3,3,5,5,6,6-octol |
|---|---|
| PubChem CID | 145316960 |
| Molecular Formula | C19H28N4O11 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | acetylene;1-[1-(3-methoxy-4-nitrophenyl)piperidin-4-yl]-4-methylpiperazine-2,2,3,3,5,5,6,6-octol |
| SMILES | C#C.COc1cc(N2CCC(N3C(O)(O)C(O)(O)N(C)C(O)(O)C3(O)O)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N4O11.C2H2/c1-18-14(22,23)16(26,27)20(17(28,29)15(18,24)25)10-5-7-19(8-6-10)11-3-4-12(21(30)31)13(9-11)32-2;1-2/h3-4,9-10,22-29H,5-8H2,1-2H3;1-2H |
| InChIKey | CSFFGOABFXHZGX-UHFFFAOYSA-N |
| XLogP | -3.38 |
| TPSA | 223.93 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|