C20H21ClN6O4 — CID 133395840
4-chloro-5-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]-2-(4-nitrophenyl)pyridazin-3-one (PubChem CID 133395840) has the molecular formula C20H21ClN6O4 and a molecular weight of 444.88 g/mol. Its IUPAC name is 4-chloro-5-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]-2-(4-nitrophenyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]-2-(4-nitrophenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 133395840 |
| Molecular Formula | C20H21ClN6O4 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 4-chloro-5-[4-[hydroxy-(1-methylimidazol-2-yl)methyl]piperidin-1-yl]-2-(4-nitrophenyl)pyridazin-3-one |
| SMILES | Cn1ccnc1C(O)C1CCN(c2cnn(-c3ccc([N+](=O)[O-])cc3)c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C20H21ClN6O4/c1-24-11-8-22-19(24)18(28)13-6-9-25(10-7-13)16-12-23-26(20(29)17(16)21)14-2-4-15(5-3-14)27(30)31/h2-5,8,11-13,18,28H,6-7,9-10H2,1H3 |
| InChIKey | XFOCZFKSVVXCTQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 119.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|